C17H10F3N3O2S — CID 1077837
N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]-9H-xanthene-9-carboxamide (PubChem CID 1077837) has the molecular formula C17H10F3N3O2S and a molecular weight of 377.35 g/mol. Its IUPAC name is N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 1077837 |
| Molecular Formula | C17H10F3N3O2S |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]-9H-xanthene-9-carboxamide |
| SMILES | O=C(Nc1nnc(C(F)(F)F)s1)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C17H10F3N3O2S/c18-17(19,20)15-22-23-16(26-15)21-14(24)13-9-5-1-3-7-11(9)25-12-8-4-2-6-10(12)13/h1-8,13H,(H,21,23,24) |
| InChIKey | LQTDNABTUIFZIK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |