C20H19N3O3S — CID 2229462
N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-9H-xanthene-9-carboxamide (PubChem CID 2229462) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 2229462 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[5-(2-ethoxyethyl)-1,3,4-thiadiazol-2-yl]-9H-xanthene-9-carboxamide |
| SMILES | CCOCCc1nnc(NC(=O)C2c3ccccc3Oc3ccccc32)s1 |
| InChI | InChI=1S/C20H19N3O3S/c1-2-25-12-11-17-22-23-20(27-17)21-19(24)18-13-7-3-5-9-15(13)26-16-10-6-4-8-14(16)18/h3-10,18H,2,11-12H2,1H3,(H,21,23,24) |
| InChIKey | ZPJZIORGEDOVHL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|