C14H9FN4O2 — CID 107793274
2-fluoro-4-(pyrido[2,3-b]pyrazin-6-ylamino)benzoic acid (PubChem CID 107793274) has the molecular formula C14H9FN4O2 and a molecular weight of 284.25 g/mol. Its IUPAC name is 2-fluoro-4-(pyrido[2,3-b]pyrazin-6-ylamino)benzoic acid.
| Compound Name | 2-fluoro-4-(pyrido[2,3-b]pyrazin-6-ylamino)benzoic acid |
|---|---|
| PubChem CID | 107793274 |
| Molecular Formula | C14H9FN4O2 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-fluoro-4-(pyrido[2,3-b]pyrazin-6-ylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ccc3nccnc3n2)cc1F |
| InChI | InChI=1S/C14H9FN4O2/c15-10-7-8(1-2-9(10)14(20)21)18-12-4-3-11-13(19-12)17-6-5-16-11/h1-7H,(H,20,21)(H,17,18,19) |
| InChIKey | WCIJNNHCYVOTMC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |