C18H18N4O2S — CID 133301712
methyl 3-[[3-(pyrido[2,3-b]pyrazin-6-ylamino)phenyl]methylsulfanyl]propanoate (PubChem CID 133301712) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is methyl 3-[[3-(pyrido[2,3-b]pyrazin-6-ylamino)phenyl]methylsulfanyl]propanoate.
| Compound Name | methyl 3-[[3-(pyrido[2,3-b]pyrazin-6-ylamino)phenyl]methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 133301712 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | methyl 3-[[3-(pyrido[2,3-b]pyrazin-6-ylamino)phenyl]methylsulfanyl]propanoate |
| SMILES | COC(=O)CCSCc1cccc(Nc2ccc3nccnc3n2)c1 |
| InChI | InChI=1S/C18H18N4O2S/c1-24-17(23)7-10-25-12-13-3-2-4-14(11-13)21-16-6-5-15-18(22-16)20-9-8-19-15/h2-6,8-9,11H,7,10,12H2,1H3,(H,20,21,22) |
| InChIKey | IFLKZTHYJCRXEB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|