C15H13N3O2S — CID 107800530
methyl 5-amino-2-(1,3-benzothiazol-6-ylamino)benzoate (PubChem CID 107800530) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is methyl 5-amino-2-(1,3-benzothiazol-6-ylamino)benzoate.
| Compound Name | methyl 5-amino-2-(1,3-benzothiazol-6-ylamino)benzoate |
|---|---|
| PubChem CID | 107800530 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | methyl 5-amino-2-(1,3-benzothiazol-6-ylamino)benzoate |
| SMILES | COC(=O)c1cc(N)ccc1Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C15H13N3O2S/c1-20-15(19)11-6-9(16)2-4-12(11)18-10-3-5-13-14(7-10)21-8-17-13/h2-8,18H,16H2,1H3 |
| InChIKey | QAWKDNNVFDIJBU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|