C16H22O5 — CID 10780128
(3aS,5aR,9R,9aR)-3a-hydroxy-1,2,9-trimethoxy-4-methylidene-5,5a,6,7,8,9-hexahydrocyclopenta[i]inden-3-one (PubChem CID 10780128) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (3aS,5aR,9R,9aR)-3a-hydroxy-1,2,9-trimethoxy-4-methylidene-5,5a,6,7,8,9-hexahydrocyclopenta[i]inden-3-one.
| Compound Name | (3aS,5aR,9R,9aR)-3a-hydroxy-1,2,9-trimethoxy-4-methylidene-5,5a,6,7,8,9-hexahydrocyclopenta[i]inden-3-one |
|---|---|
| PubChem CID | 10780128 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (3aS,5aR,9R,9aR)-3a-hydroxy-1,2,9-trimethoxy-4-methylidene-5,5a,6,7,8,9-hexahydrocyclopenta[i]inden-3-one |
| SMILES | C=C1C[C@H]2CCC[C@@H](OC)[C@]23C(OC)=C(OC)C(=O)[C@]13O |
| InChI | InChI=1S/C16H22O5/c1-9-8-10-6-5-7-11(19-2)15(10)14(21-4)12(20-3)13(17)16(9,15)18/h10-11,18H,1,5-8H2,2-4H3/t10-,11-,15+,16-/m1/s1 |
| InChIKey | AIJQRVJORIIPIW-NSLUBLRVSA-N |
| XLogP | 1.57 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|