C13H16O5 — CID 10538809
(1R,5S,6R,8R)-6-deuterio-8-hydroxy-9,10-dimethoxy-7-methylidene-2-oxatricyclo[6.3.0.01,5]undec-9-en-11-one (PubChem CID 10538809) has the molecular formula C13H16O5 and a molecular weight of 253.27 g/mol. Its IUPAC name is (1R,5S,6R,8R)-6-deuterio-8-hydroxy-9,10-dimethoxy-7-methylidene-2-oxatricyclo[6.3.0.01,5]undec-9-en-11-one.
| Compound Name | (1R,5S,6R,8R)-6-deuterio-8-hydroxy-9,10-dimethoxy-7-methylidene-2-oxatricyclo[6.3.0.01,5]undec-9-en-11-one |
|---|---|
| PubChem CID | 10538809 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (1R,5S,6R,8R)-6-deuterio-8-hydroxy-9,10-dimethoxy-7-methylidene-2-oxatricyclo[6.3.0.01,5]undec-9-en-11-one |
| SMILES | [2H][C@H]1C(=C)[C@@]2(O)C(OC)=C(OC)C(=O)[C@]23OCC[C@H]13 |
| InChI | InChI=1S/C13H16O5/c1-7-6-8-4-5-18-13(8)10(14)9(16-2)11(17-3)12(7,13)15/h8,15H,1,4-6H2,2-3H3/t8-,12-,13+/m1/s1/i6D/t6-,8+,12+,13-/m0 |
| InChIKey | UXJRNFWQECVPIG-HGHALCCPSA-N |
| XLogP | 0.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|