C12H18N4O5 — CID 107828053
(2R)-2-[[1H-imidazol-2-ylmethyl(methyl)carbamoyl]amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107828053) has the molecular formula C12H18N4O5 and a molecular weight of 298.30 g/mol. Its IUPAC name is (2R)-2-[[1H-imidazol-2-ylmethyl(methyl)carbamoyl]amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-[[1H-imidazol-2-ylmethyl(methyl)carbamoyl]amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107828053 |
| Molecular Formula | C12H18N4O5 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2R)-2-[[1H-imidazol-2-ylmethyl(methyl)carbamoyl]amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)N(C)Cc1ncc[nH]1)C(=O)O |
| InChI | InChI=1S/C12H18N4O5/c1-16(7-9-13-5-6-14-9)12(20)15-8(11(18)19)3-4-10(17)21-2/h5-6,8H,3-4,7H2,1-2H3,(H,13,14)(H,15,20)(H,18,19)/t8-/m1/s1 |
| InChIKey | MLGMJWQKPDPCKE-MRVPVSSYSA-N |
| XLogP | -0.04 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |