C11H15N3O5 — CID 107831323
(2R)-2-[[2-(1H-pyrazol-5-yl)acetyl]amino]hexanedioic acid (PubChem CID 107831323) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is (2R)-2-[[2-(1H-pyrazol-5-yl)acetyl]amino]hexanedioic acid.
| Compound Name | (2R)-2-[[2-(1H-pyrazol-5-yl)acetyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 107831323 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (2R)-2-[[2-(1H-pyrazol-5-yl)acetyl]amino]hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)Cc1ccn[nH]1)C(=O)O |
| InChI | InChI=1S/C11H15N3O5/c15-9(6-7-4-5-12-14-7)13-8(11(18)19)2-1-3-10(16)17/h4-5,8H,1-3,6H2,(H,12,14)(H,13,15)(H,16,17)(H,18,19)/t8-/m1/s1 |
| InChIKey | JJCZCHDVVMNZNQ-MRVPVSSYSA-N |
| XLogP | -0.22 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |