C12H17N3O5 — CID 107831630
(2R)-2-(2-pyrazol-1-ylpropanoylamino)hexanedioic acid (PubChem CID 107831630) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is (2R)-2-(2-pyrazol-1-ylpropanoylamino)hexanedioic acid.
| Compound Name | (2R)-2-(2-pyrazol-1-ylpropanoylamino)hexanedioic acid |
|---|---|
| PubChem CID | 107831630 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (2R)-2-(2-pyrazol-1-ylpropanoylamino)hexanedioic acid |
| SMILES | CC(C(=O)N[C@H](CCCC(=O)O)C(=O)O)n1cccn1 |
| InChI | InChI=1S/C12H17N3O5/c1-8(15-7-3-6-13-15)11(18)14-9(12(19)20)4-2-5-10(16)17/h3,6-9H,2,4-5H2,1H3,(H,14,18)(H,16,17)(H,19,20)/t8?,9-/m1/s1 |
| InChIKey | NVNBFNSBLCKTKO-YGPZHTELSA-N |
| XLogP | 0.27 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |