C12H22N2O7 — CID 107839122
(2S)-4-[[(2-ethoxy-2-oxoethyl)-(2-methoxyethyl)carbamoyl]amino]-2-hydroxybutanoic acid (PubChem CID 107839122) has the molecular formula C12H22N2O7 and a molecular weight of 306.32 g/mol. Its IUPAC name is (2S)-4-[[(2-ethoxy-2-oxoethyl)-(2-methoxyethyl)carbamoyl]amino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[[(2-ethoxy-2-oxoethyl)-(2-methoxyethyl)carbamoyl]amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107839122 |
| Molecular Formula | C12H22N2O7 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (2S)-4-[[(2-ethoxy-2-oxoethyl)-(2-methoxyethyl)carbamoyl]amino]-2-hydroxybutanoic acid |
| SMILES | CCOC(=O)CN(CCOC)C(=O)NCC[C@H](O)C(=O)O |
| InChI | InChI=1S/C12H22N2O7/c1-3-21-10(16)8-14(6-7-20-2)12(19)13-5-4-9(15)11(17)18/h9,15H,3-8H2,1-2H3,(H,13,19)(H,17,18)/t9-/m0/s1 |
| InChIKey | LAHXKXQCXGQPIE-VIFPVBQESA-N |
| XLogP | -0.96 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |