C22H26N2O2 — CID 10784072
3-[3-(1,3-dioxolan-2-yl)-N-hexylanilino]benzonitrile (PubChem CID 10784072) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-[3-(1,3-dioxolan-2-yl)-N-hexylanilino]benzonitrile.
| Compound Name | 3-[3-(1,3-dioxolan-2-yl)-N-hexylanilino]benzonitrile |
|---|---|
| PubChem CID | 10784072 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 3-[3-(1,3-dioxolan-2-yl)-N-hexylanilino]benzonitrile |
| SMILES | CCCCCCN(c1cccc(C#N)c1)c1cccc(C2OCCO2)c1 |
| InChI | InChI=1S/C22H26N2O2/c1-2-3-4-5-12-24(20-10-6-8-18(15-20)17-23)21-11-7-9-19(16-21)22-25-13-14-26-22/h6-11,15-16,22H,2-5,12-14H2,1H3 |
| InChIKey | RNJHIPMTRZNVNP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|