C11H16BrNO4 — CID 107850924
2-[(5-bromo-2-hydroxyphenyl)methylamino]-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 107850924) has the molecular formula C11H16BrNO4 and a molecular weight of 306.16 g/mol. Its IUPAC name is 2-[(5-bromo-2-hydroxyphenyl)methylamino]-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-[(5-bromo-2-hydroxyphenyl)methylamino]-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 107850924 |
| Molecular Formula | C11H16BrNO4 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-[(5-bromo-2-hydroxyphenyl)methylamino]-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | OCC(CO)(CO)NCc1cc(Br)ccc1O |
| InChI | InChI=1S/C11H16BrNO4/c12-9-1-2-10(17)8(3-9)4-13-11(5-14,6-15)7-16/h1-3,13-17H,4-7H2 |
| InChIKey | JMYWAKPWKBDNHW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|