C11H17NO5 — CID 107851106
2-[(2,3-dihydroxyphenyl)methylamino]-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 107851106) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-[(2,3-dihydroxyphenyl)methylamino]-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-[(2,3-dihydroxyphenyl)methylamino]-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 107851106 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-[(2,3-dihydroxyphenyl)methylamino]-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | OCC(CO)(CO)NCc1cccc(O)c1O |
| InChI | InChI=1S/C11H17NO5/c13-5-11(6-14,7-15)12-4-8-2-1-3-9(16)10(8)17/h1-3,12-17H,4-7H2 |
| InChIKey | AVVQIIUYZIXJGH-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|