C19H20N2O4S — CID 10785513
ethyl (E)-3-[2-(acetyloxymethylsulfanyl)-1-cyano-6,8-dimethylindolizin-3-yl]prop-2-enoate (PubChem CID 10785513) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is ethyl (E)-3-[2-(acetyloxymethylsulfanyl)-1-cyano-6,8-dimethylindolizin-3-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-(acetyloxymethylsulfanyl)-1-cyano-6,8-dimethylindolizin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10785513 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | ethyl (E)-3-[2-(acetyloxymethylsulfanyl)-1-cyano-6,8-dimethylindolizin-3-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(SCOC(C)=O)c(C#N)c2c(C)cc(C)cn12 |
| InChI | InChI=1S/C19H20N2O4S/c1-5-24-17(23)7-6-16-19(26-11-25-14(4)22)15(9-20)18-13(3)8-12(2)10-21(16)18/h6-8,10H,5,11H2,1-4H3/b7-6+ |
| InChIKey | UACXYHYZFZMRHX-VOTSOKGWSA-N |
| XLogP | 3.62 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|