C18H20N2O2S — CID 134872569
ethyl (E)-3-(1-cyano-6,7,8-trimethyl-2-methylsulfanylindolizin-3-yl)prop-2-enoate (PubChem CID 134872569) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is ethyl (E)-3-(1-cyano-6,7,8-trimethyl-2-methylsulfanylindolizin-3-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(1-cyano-6,7,8-trimethyl-2-methylsulfanylindolizin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 134872569 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | ethyl (E)-3-(1-cyano-6,7,8-trimethyl-2-methylsulfanylindolizin-3-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(SC)c(C#N)c2c(C)c(C)c(C)cn12 |
| InChI | InChI=1S/C18H20N2O2S/c1-6-22-16(21)8-7-15-18(23-5)14(9-19)17-13(4)12(3)11(2)10-20(15)17/h7-8,10H,6H2,1-5H3/b8-7+ |
| InChIKey | CNNNMAQNMMCETE-BQYQJAHWSA-N |
| XLogP | 4.03 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|