C22H21N3O2 — CID 149163369
ethyl (E)-3-(1-benzyl-3-cyano-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl)prop-2-enoate (PubChem CID 149163369) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is ethyl (E)-3-(1-benzyl-3-cyano-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(1-benzyl-3-cyano-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 149163369 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | ethyl (E)-3-(1-benzyl-3-cyano-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(C#N)c2c(C)cc(C)nc2n1Cc1ccccc1 |
| InChI | InChI=1S/C22H21N3O2/c1-4-27-20(26)11-10-19-18(13-23)21-15(2)12-16(3)24-22(21)25(19)14-17-8-6-5-7-9-17/h5-12H,4,14H2,1-3H3/b11-10+ |
| InChIKey | GZUFLLOBIDHWEB-ZHACJKMWSA-N |
| XLogP | 4.15 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|