C18H14FNO5S — CID 10785677
(1,1-dioxo-1-benzothiophen-2-yl)methyl N-[(1R)-2-fluoro-2-oxo-1-phenylethyl]carbamate (PubChem CID 10785677) has the molecular formula C18H14FNO5S and a molecular weight of 375.38 g/mol. Its IUPAC name is (1,1-dioxo-1-benzothiophen-2-yl)methyl N-[(1R)-2-fluoro-2-oxo-1-phenylethyl]carbamate.
| Compound Name | (1,1-dioxo-1-benzothiophen-2-yl)methyl N-[(1R)-2-fluoro-2-oxo-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 10785677 |
| Molecular Formula | C18H14FNO5S |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | (1,1-dioxo-1-benzothiophen-2-yl)methyl N-[(1R)-2-fluoro-2-oxo-1-phenylethyl]carbamate |
| SMILES | O=C(N[C@@H](C(=O)F)c1ccccc1)OCC1=Cc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C18H14FNO5S/c19-17(21)16(12-6-2-1-3-7-12)20-18(22)25-11-14-10-13-8-4-5-9-15(13)26(14,23)24/h1-10,16H,11H2,(H,20,22)/t16-/m1/s1 |
| InChIKey | HABIWDGXVNHSMU-MRXNPFEDSA-N |
| XLogP | 2.78 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|