C17H18N2O2 — CID 107863327
N-[(1R)-2-hydroxy-1-phenylethyl]-2,3-dihydro-1H-indole-3-carboxamide (PubChem CID 107863327) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[(1R)-2-hydroxy-1-phenylethyl]-2,3-dihydro-1H-indole-3-carboxamide.
| Compound Name | N-[(1R)-2-hydroxy-1-phenylethyl]-2,3-dihydro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 107863327 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-[(1R)-2-hydroxy-1-phenylethyl]-2,3-dihydro-1H-indole-3-carboxamide |
| SMILES | O=C(N[C@@H](CO)c1ccccc1)C1CNc2ccccc21 |
| InChI | InChI=1S/C17H18N2O2/c20-11-16(12-6-2-1-3-7-12)19-17(21)14-10-18-15-9-5-4-8-13(14)15/h1-9,14,16,18,20H,10-11H2,(H,19,21)/t14?,16-/m0/s1 |
| InChIKey | MCNMBUOUBWTYFR-WMCAAGNKSA-N |
| XLogP | 2.05 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |