C18H30F3NO2SSi — CID 10787680
(S)-N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-4-(trifluoromethyl)benzenesulfinamide (PubChem CID 10787680) has the molecular formula C18H30F3NO2SSi and a molecular weight of 409.59 g/mol. Its IUPAC name is (S)-N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-4-(trifluoromethyl)benzenesulfinamide.
| Compound Name | (S)-N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-4-(trifluoromethyl)benzenesulfinamide |
|---|---|
| PubChem CID | 10787680 |
| Molecular Formula | C18H30F3NO2SSi |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (S)-N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]-4-(trifluoromethyl)benzenesulfinamide |
| SMILES | CC(C)[C@H](CO[Si](C)(C)C(C)(C)C)N[S@@](=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H30F3NO2SSi/c1-13(2)16(12-24-26(6,7)17(3,4)5)22-25(23)15-10-8-14(9-11-15)18(19,20)21/h8-11,13,16,22H,12H2,1-7H3/t16-,25-/m0/s1 |
| InChIKey | FKNRAJWVEMXXPL-LMKMVOKYSA-N |
| XLogP | 5.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|