C12H24N2 — CID 107886855
N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]pentan-2-amine (PubChem CID 107886855) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]pentan-2-amine.
| Compound Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]pentan-2-amine |
|---|---|
| PubChem CID | 107886855 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]pentan-2-amine |
| SMILES | CCCC(C)NCCC1=CCNCC1 |
| InChI | InChI=1S/C12H24N2/c1-3-4-11(2)14-10-7-12-5-8-13-9-6-12/h5,11,13-14H,3-4,6-10H2,1-2H3 |
| InChIKey | FBAAFOYHUZGSAM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|