C26H50O3Si — CID 10789174
[(3aR,4S,7aS)-1-[(2S)-6-(methoxymethoxy)-6-methylheptan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10789174) has the molecular formula C26H50O3Si and a molecular weight of 438.77 g/mol. Its IUPAC name is [(3aR,4S,7aS)-1-[(2S)-6-(methoxymethoxy)-6-methylheptan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S,7aS)-1-[(2S)-6-(methoxymethoxy)-6-methylheptan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10789174 |
| Molecular Formula | C26H50O3Si |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | [(3aR,4S,7aS)-1-[(2S)-6-(methoxymethoxy)-6-methylheptan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCOC(C)(C)CCC[C@H](C)C1=CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C26H50O3Si/c1-20(13-11-17-25(5,6)28-19-27-8)21-15-16-22-23(14-12-18-26(21,22)7)29-30(9,10)24(2,3)4/h15,20,22-23H,11-14,16-19H2,1-10H3/t20-,22-,23-,26+/m0/s1 |
| InChIKey | OWLIYGYHWAPOIT-PETUGJSASA-N |
| XLogP | 7.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|