C29H56O4Si2 — CID 155933276
3-[(3aS,7aR)-2-[tert-butyl(dimethyl)silyl]oxy-7a-[3-(methoxymethoxy)propyl]-3,3a,4,5-tetrahydroinden-1-yl]propoxy-tert-butyl-dimethylsilane (PubChem CID 155933276) has the molecular formula C29H56O4Si2 and a molecular weight of 524.94 g/mol. Its IUPAC name is 3-[(3aS,7aR)-2-[tert-butyl(dimethyl)silyl]oxy-7a-[3-(methoxymethoxy)propyl]-3,3a,4,5-tetrahydroinden-1-yl]propoxy-tert-butyl-dimethylsilane.
| Compound Name | 3-[(3aS,7aR)-2-[tert-butyl(dimethyl)silyl]oxy-7a-[3-(methoxymethoxy)propyl]-3,3a,4,5-tetrahydroinden-1-yl]propoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 155933276 |
| Molecular Formula | C29H56O4Si2 |
| Molecular Weight | 524.94 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | 3-[(3aS,7aR)-2-[tert-butyl(dimethyl)silyl]oxy-7a-[3-(methoxymethoxy)propyl]-3,3a,4,5-tetrahydroinden-1-yl]propoxy-tert-butyl-dimethylsilane |
| SMILES | COCOCCC[C@]12C=CCC[C@H]1CC(O[Si](C)(C)C(C)(C)C)=C2CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H56O4Si2/c1-27(2,3)34(8,9)32-21-14-17-25-26(33-35(10,11)28(4,5)6)22-24-16-12-13-18-29(24,25)19-15-20-31-23-30-7/h13,18,24H,12,14-17,19-23H2,1-11H3/t24-,29+/m0/s1 |
| InChIKey | UHZKNNBQPBUZOA-PWUYWRBVSA-N |
| XLogP | 8.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.94 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|