C30H58O3Si — CID 10601285
[(1R,3aR,4S,7aR)-1-[(E,2R,5S)-5-[2-(methoxymethoxy)propan-2-yl]non-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10601285) has the molecular formula C30H58O3Si and a molecular weight of 494.88 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(E,2R,5S)-5-[2-(methoxymethoxy)propan-2-yl]non-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(E,2R,5S)-5-[2-(methoxymethoxy)propan-2-yl]non-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10601285 |
| Molecular Formula | C30H58O3Si |
| Molecular Weight | 494.88 g/mol |
| Exact Mass | 494.42 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(E,2R,5S)-5-[2-(methoxymethoxy)propan-2-yl]non-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCC[C@@H](/C=C/[C@@H](C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C)C(C)(C)OCOC |
| InChI | InChI=1S/C30H58O3Si/c1-12-13-15-24(29(6,7)32-22-31-9)18-17-23(2)25-19-20-26-27(16-14-21-30(25,26)8)33-34(10,11)28(3,4)5/h17-18,23-27H,12-16,19-22H2,1-11H3/b18-17+/t23-,24+,25-,26+,27+,30-/m1/s1 |
| InChIKey | FFNYXTNTBIWUAE-SUWFVITPSA-N |
| XLogP | 8.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.88 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|