C33H58O5Si — CID 102323259
[(2S)-2-[(1R,2S,3S,6R,7R,10R,11R,13E)-2,11-bis(methoxymethoxy)-6,15-dimethyl-7-tetracyclo[12.3.1.03,11.06,10]octadeca-13,15-dienyl]propoxy]-tert-butyl-dimethylsilane (PubChem CID 102323259) has the molecular formula C33H58O5Si and a molecular weight of 562.91 g/mol. Its IUPAC name is [(2S)-2-[(1R,2S,3S,6R,7R,10R,11R,13E)-2,11-bis(methoxymethoxy)-6,15-dimethyl-7-tetracyclo[12.3.1.03,11.06,10]octadeca-13,15-dienyl]propoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2S)-2-[(1R,2S,3S,6R,7R,10R,11R,13E)-2,11-bis(methoxymethoxy)-6,15-dimethyl-7-tetracyclo[12.3.1.03,11.06,10]octadeca-13,15-dienyl]propoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102323259 |
| Molecular Formula | C33H58O5Si |
| Molecular Weight | 562.91 g/mol |
| Exact Mass | 562.41 |
| IUPAC Name | [(2S)-2-[(1R,2S,3S,6R,7R,10R,11R,13E)-2,11-bis(methoxymethoxy)-6,15-dimethyl-7-tetracyclo[12.3.1.03,11.06,10]octadeca-13,15-dienyl]propoxy]-tert-butyl-dimethylsilane |
| SMILES | COCO[C@H]1[C@@H]2CC=C(C)/C(=C/C[C@@]3(OCOC)[C@@H]4CC[C@H]([C@H](C)CO[Si](C)(C)C(C)(C)C)[C@@]4(C)CC[C@@H]13)C2 |
| InChI | InChI=1S/C33H58O5Si/c1-23-11-12-26-19-25(23)15-18-33(37-22-35-8)28(30(26)36-21-34-7)16-17-32(6)27(13-14-29(32)33)24(2)20-38-39(9,10)31(3,4)5/h11,15,24,26-30H,12-14,16-22H2,1-10H3/b25-15+/t24-,26-,27-,28+,29-,30+,32-,33+/m1/s1 |
| InChIKey | CQBYRIVFIDQXNK-DPSDHYPRSA-N |
| XLogP | 8.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.91 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|