C30H50O2Si — CID 101337720
(1S,5R,6R,9S,13E)-5-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-13-ethenyl-6-methyl-11-prop-2-ynyltricyclo[7.6.0.02,6]pentadec-13-en-1-ol (PubChem CID 101337720) has the molecular formula C30H50O2Si and a molecular weight of 470.81 g/mol. Its IUPAC name is (1S,5R,6R,9S,13E)-5-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-13-ethenyl-6-methyl-11-prop-2-ynyltricyclo[7.6.0.02,6]pentadec-13-en-1-ol.
| Compound Name | (1S,5R,6R,9S,13E)-5-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-13-ethenyl-6-methyl-11-prop-2-ynyltricyclo[7.6.0.02,6]pentadec-13-en-1-ol |
|---|---|
| PubChem CID | 101337720 |
| Molecular Formula | C30H50O2Si |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 470.36 |
| IUPAC Name | (1S,5R,6R,9S,13E)-5-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-13-ethenyl-6-methyl-11-prop-2-ynyltricyclo[7.6.0.02,6]pentadec-13-en-1-ol |
| SMILES | C#CCC1C/C(C=C)=C\C[C@@]2(O)C3CC[C@H]([C@H](C)CO[Si](C)(C)C(C)(C)C)[C@@]3(C)CC[C@H]2C1 |
| InChI | InChI=1S/C30H50O2Si/c1-10-12-24-19-23(11-2)15-18-30(31)25(20-24)16-17-29(7)26(13-14-27(29)30)22(3)21-32-33(8,9)28(4,5)6/h1,11,15,22,24-27,31H,2,12-14,16-21H2,3-9H3/b23-15-/t22-,24?,25+,26-,27?,29-,30+/m1/s1 |
| InChIKey | NTJGCZYDOFBREZ-DBJXACCISA-N |
| XLogP | 7.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|