C28H48O2Si — CID 91217901
(6R,7R,11S)-7-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-methyltetracyclo[12.3.1.03,11.06,10]octadeca-13,15-dien-11-ol (PubChem CID 91217901) has the molecular formula C28H48O2Si and a molecular weight of 444.78 g/mol. Its IUPAC name is (6R,7R,11S)-7-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-methyltetracyclo[12.3.1.03,11.06,10]octadeca-13,15-dien-11-ol.
| Compound Name | (6R,7R,11S)-7-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-methyltetracyclo[12.3.1.03,11.06,10]octadeca-13,15-dien-11-ol |
|---|---|
| PubChem CID | 91217901 |
| Molecular Formula | C28H48O2Si |
| Molecular Weight | 444.78 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | (6R,7R,11S)-7-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-methyltetracyclo[12.3.1.03,11.06,10]octadeca-13,15-dien-11-ol |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1CCC2[C@]3(O)CC=C4C=CCC(C4)CC3CC[C@@]21C |
| InChI | InChI=1S/C28H48O2Si/c1-20(19-30-31(6,7)26(2,3)4)24-11-12-25-27(24,5)15-14-23-18-22-10-8-9-21(17-22)13-16-28(23,25)29/h8-9,13,20,22-25,29H,10-12,14-19H2,1-7H3/t20-,22?,23?,24-,25?,27-,28+/m1/s1 |
| InChIKey | JFLYUCFNBOXGSJ-BEZFUZBESA-N |
| XLogP | 7.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.78 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|