C29H54O3Si — CID 10648352
[(1R,3aR,4S,7aR)-1-[(E,2R,5S)-5-cyclopropyl-6-(methoxymethoxy)-6-methylhept-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10648352) has the molecular formula C29H54O3Si and a molecular weight of 478.83 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(E,2R,5S)-5-cyclopropyl-6-(methoxymethoxy)-6-methylhept-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(E,2R,5S)-5-cyclopropyl-6-(methoxymethoxy)-6-methylhept-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10648352 |
| Molecular Formula | C29H54O3Si |
| Molecular Weight | 478.83 g/mol |
| Exact Mass | 478.38 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(E,2R,5S)-5-cyclopropyl-6-(methoxymethoxy)-6-methylhept-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCOC(C)(C)[C@H](/C=C/[C@@H](C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C)C1CC1 |
| InChI | InChI=1S/C29H54O3Si/c1-21(13-16-24(22-14-15-22)28(5,6)31-20-30-8)23-17-18-25-26(12-11-19-29(23,25)7)32-33(9,10)27(2,3)4/h13,16,21-26H,11-12,14-15,17-20H2,1-10H3/b16-13+/t21-,23-,24-,25+,26+,29-/m1/s1 |
| InChIKey | VMLAWNMDPZGCNK-CRRHIEIPSA-N |
| XLogP | 8.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.83 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|