C25H48O2Si — CID 15138758
(E,3R,6R)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,3-dimethylhept-4-en-2-ol (PubChem CID 15138758) has the molecular formula C25H48O2Si and a molecular weight of 408.74 g/mol. Its IUPAC name is (E,3R,6R)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,3-dimethylhept-4-en-2-ol.
| Compound Name | (E,3R,6R)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,3-dimethylhept-4-en-2-ol |
|---|---|
| PubChem CID | 15138758 |
| Molecular Formula | C25H48O2Si |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | (E,3R,6R)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,3-dimethylhept-4-en-2-ol |
| SMILES | C[C@H](/C=C/[C@@H](C)C(C)(C)O)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C25H48O2Si/c1-18(13-14-19(2)24(6,7)26)20-15-16-21-22(12-11-17-25(20,21)8)27-28(9,10)23(3,4)5/h13-14,18-22,26H,11-12,15-17H2,1-10H3/b14-13+/t18-,19-,20-,21+,22+,25-/m1/s1 |
| InChIKey | VCTXSFGHAZDFQZ-MIPMEJJASA-N |
| XLogP | 7.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|