C10H20BrN — CID 107901221
N-(3-bromobutyl)-N,3-dimethylbut-2-en-1-amine (PubChem CID 107901221) has the molecular formula C10H20BrN and a molecular weight of 234.18 g/mol. Its IUPAC name is N-(3-bromobutyl)-N,3-dimethylbut-2-en-1-amine.
| Compound Name | N-(3-bromobutyl)-N,3-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 107901221 |
| Molecular Formula | C10H20BrN |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N-(3-bromobutyl)-N,3-dimethylbut-2-en-1-amine |
| SMILES | CC(C)=CCN(C)CCC(C)Br |
| InChI | InChI=1S/C10H20BrN/c1-9(2)5-7-12(4)8-6-10(3)11/h5,10H,6-8H2,1-4H3 |
| InChIKey | ZYBGMPPMQVCMKK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|