C9H18ClN — CID 107900993
N-(2-chloropropyl)-N,3-dimethylbut-2-en-1-amine (PubChem CID 107900993) has the molecular formula C9H18ClN and a molecular weight of 175.70 g/mol. Its IUPAC name is N-(2-chloropropyl)-N,3-dimethylbut-2-en-1-amine.
| Compound Name | N-(2-chloropropyl)-N,3-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 107900993 |
| Molecular Formula | C9H18ClN |
| Molecular Weight | 175.70 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N-(2-chloropropyl)-N,3-dimethylbut-2-en-1-amine |
| SMILES | CC(C)=CCN(C)CC(C)Cl |
| InChI | InChI=1S/C9H18ClN/c1-8(2)5-6-11(4)7-9(3)10/h5,9H,6-7H2,1-4H3 |
| InChIKey | WUGCMXOTASMUAW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.70 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|