C8H15N5 — CID 107912121
1-(2-pyrrolidin-1-ylethyl)-1,2,4-triazol-3-amine (PubChem CID 107912121) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-(2-pyrrolidin-1-ylethyl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(2-pyrrolidin-1-ylethyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 107912121 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1-(2-pyrrolidin-1-ylethyl)-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(CCN2CCCC2)n1 |
| InChI | InChI=1S/C8H15N5/c9-8-10-7-13(11-8)6-5-12-3-1-2-4-12/h7H,1-6H2,(H2,9,11) |
| InChIKey | OUCGEROWMMUVQD-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |