C12H25BrN2O — CID 107914046
2-[2-(bromomethyl)-6-methylmorpholin-4-yl]-N,N-diethylethanamine (PubChem CID 107914046) has the molecular formula C12H25BrN2O and a molecular weight of 293.25 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-6-methylmorpholin-4-yl]-N,N-diethylethanamine.
| Compound Name | 2-[2-(bromomethyl)-6-methylmorpholin-4-yl]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 107914046 |
| Molecular Formula | C12H25BrN2O |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-[2-(bromomethyl)-6-methylmorpholin-4-yl]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCN1CC(C)OC(CBr)C1 |
| InChI | InChI=1S/C12H25BrN2O/c1-4-14(5-2)6-7-15-9-11(3)16-12(8-13)10-15/h11-12H,4-10H2,1-3H3 |
| InChIKey | SRZJYVTVDVEXNE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|