C22H31NO13 — CID 10792005
[(2S,3S,4R)-4-[(2R,3S,4S)-1-acetyl-3,4-diacetyloxypyrrolidin-2-yl]-2,3,4-triacetyloxybutyl] acetate (PubChem CID 10792005) has the molecular formula C22H31NO13 and a molecular weight of 517.48 g/mol. Its IUPAC name is [(2S,3S,4R)-4-[(2R,3S,4S)-1-acetyl-3,4-diacetyloxypyrrolidin-2-yl]-2,3,4-triacetyloxybutyl] acetate.
| Compound Name | [(2S,3S,4R)-4-[(2R,3S,4S)-1-acetyl-3,4-diacetyloxypyrrolidin-2-yl]-2,3,4-triacetyloxybutyl] acetate |
|---|---|
| PubChem CID | 10792005 |
| Molecular Formula | C22H31NO13 |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | [(2S,3S,4R)-4-[(2R,3S,4S)-1-acetyl-3,4-diacetyloxypyrrolidin-2-yl]-2,3,4-triacetyloxybutyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)CN1C(C)=O |
| InChI | InChI=1S/C22H31NO13/c1-10(24)23-8-17(32-12(3)26)20(34-14(5)28)19(23)22(36-16(7)30)21(35-15(6)29)18(33-13(4)27)9-31-11(2)25/h17-22H,8-9H2,1-7H3/t17-,18-,19+,20+,21+,22+/m0/s1 |
| InChIKey | QOVDOAFYINGEON-IUVRRTPNSA-N |
| XLogP | -0.56 |
| TPSA | 178.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|