C11H10N4O — CID 107937146
2-(5-amino-3-methyl-2-oxo-4H-imidazol-4-yl)benzonitrile (PubChem CID 107937146) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is 2-(5-amino-3-methyl-2-oxo-4H-imidazol-4-yl)benzonitrile.
| Compound Name | 2-(5-amino-3-methyl-2-oxo-4H-imidazol-4-yl)benzonitrile |
|---|---|
| PubChem CID | 107937146 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-(5-amino-3-methyl-2-oxo-4H-imidazol-4-yl)benzonitrile |
| SMILES | CN1C(=O)N=C(N)C1c1ccccc1C#N |
| InChI | InChI=1S/C11H10N4O/c1-15-9(10(13)14-11(15)16)8-5-3-2-4-7(8)6-12/h2-5,9H,1H3,(H2,13,14,16) |
| InChIKey | CHDQFUMQOWWSSY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |