C32H51NO8Si — CID 10793765
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,2S,6R,7S,8R,9R)-4,4-dimethyl-8-phenylmethoxy-3,5,10,12-tetraoxatricyclo[7.2.1.02,7]dodecan-6-yl]pyrrolidine-1-carboxylate (PubChem CID 10793765) has the molecular formula C32H51NO8Si and a molecular weight of 605.85 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,2S,6R,7S,8R,9R)-4,4-dimethyl-8-phenylmethoxy-3,5,10,12-tetraoxatricyclo[7.2.1.02,7]dodecan-6-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,2S,6R,7S,8R,9R)-4,4-dimethyl-8-phenylmethoxy-3,5,10,12-tetraoxatricyclo[7.2.1.02,7]dodecan-6-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10793765 |
| Molecular Formula | C32H51NO8Si |
| Molecular Weight | 605.85 g/mol |
| Exact Mass | 605.34 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,2S,6R,7S,8R,9R)-4,4-dimethyl-8-phenylmethoxy-3,5,10,12-tetraoxatricyclo[7.2.1.02,7]dodecan-6-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1[C@@H]1OC(C)(C)O[C@H]2[C@H]1[C@@H](OCc1ccccc1)[C@@H]1OC[C@H]2O1 |
| InChI | InChI=1S/C32H51NO8Si/c1-30(2,3)40-29(34)33-17-21(41-42(9,10)31(4,5)6)16-22(33)25-24-26(39-32(7,8)38-25)23-19-36-28(37-23)27(24)35-18-20-14-12-11-13-15-20/h11-15,21-28H,16-19H2,1-10H3/t21-,22+,23-,24+,25+,26-,27-,28-/m1/s1 |
| InChIKey | VBIYZABVKHCHDZ-BMNVVFCNSA-N |
| XLogP | 5.86 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.85 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|