C8H4BrClN2OS — CID 107939328
5-(3-bromo-5-chlorophenyl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 107939328) has the molecular formula C8H4BrClN2OS and a molecular weight of 291.56 g/mol. Its IUPAC name is 5-(3-bromo-5-chlorophenyl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(3-bromo-5-chlorophenyl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 107939328 |
| Molecular Formula | C8H4BrClN2OS |
| Molecular Weight | 291.56 g/mol |
| Exact Mass | 289.89 |
| IUPAC Name | 5-(3-bromo-5-chlorophenyl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(-c2cc(Cl)cc(Br)c2)o1 |
| InChI | InChI=1S/C8H4BrClN2OS/c9-5-1-4(2-6(10)3-5)7-11-12-8(14)13-7/h1-3H,(H,12,14) |
| InChIKey | KTJZNDUXZWZJGH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|