C14H10N2OS — CID 12602645
5-(3-phenylphenyl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 12602645) has the molecular formula C14H10N2OS and a molecular weight of 254.31 g/mol. Its IUPAC name is 5-(3-phenylphenyl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(3-phenylphenyl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 12602645 |
| Molecular Formula | C14H10N2OS |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 5-(3-phenylphenyl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(-c2cccc(-c3ccccc3)c2)o1 |
| InChI | InChI=1S/C14H10N2OS/c18-14-16-15-13(17-14)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H,(H,16,18) |
| InChIKey | AGMWFRVAWHRSIH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|