C7H13N3O — CID 107939360
5-methyl-3-(propoxymethyl)-1H-1,2,4-triazole (PubChem CID 107939360) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 5-methyl-3-(propoxymethyl)-1H-1,2,4-triazole.
| Compound Name | 5-methyl-3-(propoxymethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 107939360 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 5-methyl-3-(propoxymethyl)-1H-1,2,4-triazole |
| SMILES | CCCOCc1n[nH]c(C)n1 |
| InChI | InChI=1S/C7H13N3O/c1-3-4-11-5-7-8-6(2)9-10-7/h3-5H2,1-2H3,(H,8,9,10) |
| InChIKey | WCZLHTACEWDJAE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|