C6H14N4 — CID 144769727
ethane;(5-methyl-1H-1,2,4-triazol-3-yl)methanamine (PubChem CID 144769727) has the molecular formula C6H14N4 and a molecular weight of 142.21 g/mol. Its IUPAC name is ethane;(5-methyl-1H-1,2,4-triazol-3-yl)methanamine.
| Compound Name | ethane;(5-methyl-1H-1,2,4-triazol-3-yl)methanamine |
|---|---|
| PubChem CID | 144769727 |
| Molecular Formula | C6H14N4 |
| Molecular Weight | 142.21 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | ethane;(5-methyl-1H-1,2,4-triazol-3-yl)methanamine |
| SMILES | CC.Cc1nc(CN)n[nH]1 |
| InChI | InChI=1S/C4H8N4.C2H6/c1-3-6-4(2-5)8-7-3;1-2/h2,5H2,1H3,(H,6,7,8);1-2H3 |
| InChIKey | BDIHEWLUQOIDPU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |