C6H12N6 — CID 168912786
(Z)-2-[amino-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]amino]ethenamine (PubChem CID 168912786) has the molecular formula C6H12N6 and a molecular weight of 168.20 g/mol. Its IUPAC name is (Z)-2-[amino-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]amino]ethenamine.
| Compound Name | (Z)-2-[amino-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]amino]ethenamine |
|---|---|
| PubChem CID | 168912786 |
| Molecular Formula | C6H12N6 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | (Z)-2-[amino-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]amino]ethenamine |
| SMILES | Cc1nc(CN(N)/C=C\N)n[nH]1 |
| InChI | InChI=1S/C6H12N6/c1-5-9-6(11-10-5)4-12(8)3-2-7/h2-3H,4,7-8H2,1H3,(H,9,10,11)/b3-2- |
| InChIKey | FZBAKISINKOQJL-IHWYPQMZSA-N |
| XLogP | -0.78 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|