About 5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole
5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole (PubChem CID 142566121) has the molecular formula C5H9N3OS
and a molecular weight of 159.21 g/mol. Its IUPAC name is 5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole.
Analyze 5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole?
The IUPAC name of 5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole (CID 142566121) is 5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole.
What is the SMILES notation for 5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole?
The canonical SMILES for 5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole is Cc1nc(CS(C)=O)n[nH]1.
What is the InChIKey of 5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole?
The InChIKey is JNJVWFIRPMLSJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3OS/c1-4-6-5(8-7-4)3-10(2)9/h3H2,1-2H3,(H,6,7,8).
What are the key properties of 5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole?
5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole has a molecular weight of 159.21 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(methylsulfinylmethyl)-1H-1,2,4-triazole is sourced from PubChem (CID 142566121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).