C30H22F8O2P2 — CID 10794037
[(1S,2S)-2-bis(3,5-difluorophenyl)phosphanyloxycyclohexyl]oxy-bis(3,5-difluorophenyl)phosphane (PubChem CID 10794037) has the molecular formula C30H22F8O2P2 and a molecular weight of 628.44 g/mol. Its IUPAC name is [(1S,2S)-2-bis(3,5-difluorophenyl)phosphanyloxycyclohexyl]oxy-bis(3,5-difluorophenyl)phosphane.
| Compound Name | [(1S,2S)-2-bis(3,5-difluorophenyl)phosphanyloxycyclohexyl]oxy-bis(3,5-difluorophenyl)phosphane |
|---|---|
| PubChem CID | 10794037 |
| Molecular Formula | C30H22F8O2P2 |
| Molecular Weight | 628.44 g/mol |
| Exact Mass | 628.10 |
| IUPAC Name | [(1S,2S)-2-bis(3,5-difluorophenyl)phosphanyloxycyclohexyl]oxy-bis(3,5-difluorophenyl)phosphane |
| SMILES | Fc1cc(F)cc(P(O[C@H]2CCCC[C@@H]2OP(c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C30H22F8O2P2/c31-17-5-18(32)10-25(9-17)41(26-11-19(33)6-20(34)12-26)39-29-3-1-2-4-30(29)40-42(27-13-21(35)7-22(36)14-27)28-15-23(37)8-24(38)16-28/h5-16,29-30H,1-4H2/t29-,30-/m0/s1 |
| InChIKey | CVFAKVFQGUKJFF-KYJUHHDHSA-N |
| XLogP | 7.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.44 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|