C27H35BrO8S2Si — CID 10794435
[(1S,4R,5S,6S)-4-[bis(benzenesulfonyl)methyl]-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl] methyl carbonate (PubChem CID 10794435) has the molecular formula C27H35BrO8S2Si and a molecular weight of 659.69 g/mol. Its IUPAC name is [(1S,4R,5S,6S)-4-[bis(benzenesulfonyl)methyl]-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl] methyl carbonate.
| Compound Name | [(1S,4R,5S,6S)-4-[bis(benzenesulfonyl)methyl]-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl] methyl carbonate |
|---|---|
| PubChem CID | 10794435 |
| Molecular Formula | C27H35BrO8S2Si |
| Molecular Weight | 659.69 g/mol |
| Exact Mass | 658.07 |
| IUPAC Name | [(1S,4R,5S,6S)-4-[bis(benzenesulfonyl)methyl]-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl] methyl carbonate |
| SMILES | COC(=O)O[C@H]1C=C[C@@H](C(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1Br |
| InChI | InChI=1S/C27H35BrO8S2Si/c1-27(2,3)39(5,6)36-24-21(17-18-22(23(24)28)35-26(29)34-4)25(37(30,31)19-13-9-7-10-14-19)38(32,33)20-15-11-8-12-16-20/h7-18,21-25H,1-6H3/t21-,22+,23+,24+/m1/s1 |
| InChIKey | UIGXGLJXMMUXAY-SBFWRKJZSA-N |
| XLogP | 5.75 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.69 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|