C29H42O9S2Si — CID 102316118
[(E,4R)-4-[(2R,3S)-6,6-bis(benzenesulfonyl)-3-trimethylsilyloxyhexan-2-yl]oxyhex-2-enyl] methyl carbonate (PubChem CID 102316118) has the molecular formula C29H42O9S2Si and a molecular weight of 626.87 g/mol. Its IUPAC name is [(E,4R)-4-[(2R,3S)-6,6-bis(benzenesulfonyl)-3-trimethylsilyloxyhexan-2-yl]oxyhex-2-enyl] methyl carbonate.
| Compound Name | [(E,4R)-4-[(2R,3S)-6,6-bis(benzenesulfonyl)-3-trimethylsilyloxyhexan-2-yl]oxyhex-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 102316118 |
| Molecular Formula | C29H42O9S2Si |
| Molecular Weight | 626.87 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | [(E,4R)-4-[(2R,3S)-6,6-bis(benzenesulfonyl)-3-trimethylsilyloxyhexan-2-yl]oxyhex-2-enyl] methyl carbonate |
| SMILES | CC[C@H](/C=C/COC(=O)OC)O[C@H](C)[C@H](CCC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C29H42O9S2Si/c1-7-24(15-14-22-36-29(30)35-3)37-23(2)27(38-41(4,5)6)20-21-28(39(31,32)25-16-10-8-11-17-25)40(33,34)26-18-12-9-13-19-26/h8-19,23-24,27-28H,7,20-22H2,1-6H3/b15-14+/t23-,24-,27+/m1/s1 |
| InChIKey | ZUWCUKIGDVOBCA-HADRVGLLSA-N |
| XLogP | 5.78 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.87 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|