C29H42O8S2Si — CID 102316115
ethyl (E)-4-[(2R,3S)-6,6-bis(benzenesulfonyl)-3-trimethylsilyloxyhexan-2-yl]oxyhex-2-enoate (PubChem CID 102316115) has the molecular formula C29H42O8S2Si and a molecular weight of 610.87 g/mol. Its IUPAC name is ethyl (E)-4-[(2R,3S)-6,6-bis(benzenesulfonyl)-3-trimethylsilyloxyhexan-2-yl]oxyhex-2-enoate.
| Compound Name | ethyl (E)-4-[(2R,3S)-6,6-bis(benzenesulfonyl)-3-trimethylsilyloxyhexan-2-yl]oxyhex-2-enoate |
|---|---|
| PubChem CID | 102316115 |
| Molecular Formula | C29H42O8S2Si |
| Molecular Weight | 610.87 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | ethyl (E)-4-[(2R,3S)-6,6-bis(benzenesulfonyl)-3-trimethylsilyloxyhexan-2-yl]oxyhex-2-enoate |
| SMILES | CCOC(=O)/C=C/C(CC)O[C@H](C)[C@H](CCC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C29H42O8S2Si/c1-7-24(19-21-28(30)35-8-2)36-23(3)27(37-40(4,5)6)20-22-29(38(31,32)25-15-11-9-12-16-25)39(33,34)26-17-13-10-14-18-26/h9-19,21,23-24,27,29H,7-8,20,22H2,1-6H3/b21-19+/t23-,24?,27+/m1/s1 |
| InChIKey | OAGXHVWRHNXNEG-KOUPBBDSSA-N |
| XLogP | 5.56 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.87 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|