About 3-bromo-4-fluorobenzoyl isocyanate
3-bromo-4-fluorobenzoyl isocyanate (PubChem CID 107948685) has the molecular formula C8H3BrFNO2
and a molecular weight of 244.02 g/mol. Its IUPAC name is 3-bromo-4-fluorobenzoyl isocyanate.
Molecular Properties
| Compound Name | 3-bromo-4-fluorobenzoyl isocyanate |
| PubChem CID | 107948685 |
| Molecular Formula | C8H3BrFNO2 |
| Molecular Weight | 244.02 g/mol |
| Exact Mass | 242.93 |
| IUPAC Name | 3-bromo-4-fluorobenzoyl isocyanate |
| SMILES | O=C=NC(=O)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C8H3BrFNO2/c9-6-3-5(1-2-7(6)10)8(13)11-4-12/h1-3H |
| InChIKey | AUOFCNYLAAHQIO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.02 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-fluorobenzoyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-fluorobenzoyl isocyanate?
The IUPAC name of 3-bromo-4-fluorobenzoyl isocyanate (CID 107948685) is 3-bromo-4-fluorobenzoyl isocyanate.
What is the SMILES notation for 3-bromo-4-fluorobenzoyl isocyanate?
The canonical SMILES for 3-bromo-4-fluorobenzoyl isocyanate is O=C=NC(=O)c1ccc(F)c(Br)c1.
What is the InChIKey of 3-bromo-4-fluorobenzoyl isocyanate?
The InChIKey is AUOFCNYLAAHQIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrFNO2/c9-6-3-5(1-2-7(6)10)8(13)11-4-12/h1-3H.
What are the key properties of 3-bromo-4-fluorobenzoyl isocyanate?
3-bromo-4-fluorobenzoyl isocyanate has a molecular weight of 244.02 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-fluorobenzoyl isocyanate is sourced from PubChem (CID 107948685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).