About 3-bromo-2-fluorobenzoyl isothiocyanate
3-bromo-2-fluorobenzoyl isothiocyanate (PubChem CID 107957059) has the molecular formula C8H3BrFNOS
and a molecular weight of 260.09 g/mol. Its IUPAC name is 3-bromo-2-fluorobenzoyl isothiocyanate.
Molecular Properties
| Compound Name | 3-bromo-2-fluorobenzoyl isothiocyanate |
| PubChem CID | 107957059 |
| Molecular Formula | C8H3BrFNOS |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 258.91 |
| IUPAC Name | 3-bromo-2-fluorobenzoyl isothiocyanate |
| SMILES | O=C(N=C=S)c1cccc(Br)c1F |
| InChI | InChI=1S/C8H3BrFNOS/c9-6-3-1-2-5(7(6)10)8(12)11-4-13/h1-3H |
| InChIKey | DWVDAGOVVRSWKI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-fluorobenzoyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-fluorobenzoyl isothiocyanate?
The IUPAC name of 3-bromo-2-fluorobenzoyl isothiocyanate (CID 107957059) is 3-bromo-2-fluorobenzoyl isothiocyanate.
What is the SMILES notation for 3-bromo-2-fluorobenzoyl isothiocyanate?
The canonical SMILES for 3-bromo-2-fluorobenzoyl isothiocyanate is O=C(N=C=S)c1cccc(Br)c1F.
What is the InChIKey of 3-bromo-2-fluorobenzoyl isothiocyanate?
The InChIKey is DWVDAGOVVRSWKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrFNOS/c9-6-3-1-2-5(7(6)10)8(12)11-4-13/h1-3H.
What are the key properties of 3-bromo-2-fluorobenzoyl isothiocyanate?
3-bromo-2-fluorobenzoyl isothiocyanate has a molecular weight of 260.09 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-fluorobenzoyl isothiocyanate is sourced from PubChem (CID 107957059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).