C8H11Br2NS — CID 107961478
N-[(2,5-dibromothiophen-3-yl)methyl]propan-2-amine (PubChem CID 107961478) has the molecular formula C8H11Br2NS and a molecular weight of 313.06 g/mol. Its IUPAC name is N-[(2,5-dibromothiophen-3-yl)methyl]propan-2-amine.
| Compound Name | N-[(2,5-dibromothiophen-3-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 107961478 |
| Molecular Formula | C8H11Br2NS |
| Molecular Weight | 313.06 g/mol |
| Exact Mass | 310.90 |
| IUPAC Name | N-[(2,5-dibromothiophen-3-yl)methyl]propan-2-amine |
| SMILES | CC(C)NCc1cc(Br)sc1Br |
| InChI | InChI=1S/C8H11Br2NS/c1-5(2)11-4-6-3-7(9)12-8(6)10/h3,5,11H,4H2,1-2H3 |
| InChIKey | SYSCCGAKMWTPNV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.06 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |