C9H10Cl2N2OS — CID 107963472
N-(3-aminocyclobutyl)-2,5-dichlorothiophene-3-carboxamide (PubChem CID 107963472) has the molecular formula C9H10Cl2N2OS and a molecular weight of 265.17 g/mol. Its IUPAC name is N-(3-aminocyclobutyl)-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-(3-aminocyclobutyl)-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107963472 |
| Molecular Formula | C9H10Cl2N2OS |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | N-(3-aminocyclobutyl)-2,5-dichlorothiophene-3-carboxamide |
| SMILES | NC1CC(NC(=O)c2cc(Cl)sc2Cl)C1 |
| InChI | InChI=1S/C9H10Cl2N2OS/c10-7-3-6(8(11)15-7)9(14)13-5-1-4(12)2-5/h3-5H,1-2,12H2,(H,13,14) |
| InChIKey | KBPWBASGBFDZHV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |